About 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol
2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol (PubChem CID 3611136) has the molecular formula C15H12N4O
and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol.
Molecular Properties
| Compound Name | 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol |
| PubChem CID | 3611136 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol |
| SMILES | Oc1ccccc1-c1n[nH]c(C=Cc2ccccn2)n1 |
| InChI | InChI=1S/C15H12N4O/c20-13-7-2-1-6-12(13)15-17-14(18-19-15)9-8-11-5-3-4-10-16-11/h1-10,20H,(H,17,18,19) |
| InChIKey | LVAXEMVQXKLDDT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol?
The IUPAC name of 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol (CID 3611136) is 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol.
What is the SMILES notation for 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol?
The canonical SMILES for 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol is Oc1ccccc1-c1n[nH]c(C=Cc2ccccn2)n1.
What is the InChIKey of 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol?
The InChIKey is LVAXEMVQXKLDDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O/c20-13-7-2-1-6-12(13)15-17-14(18-19-15)9-8-11-5-3-4-10-16-11/h1-10,20H,(H,17,18,19).
What are the key properties of 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol?
2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol has a molecular weight of 264.29 g/mol, XLogP of 2.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-pyridin-2-ylethenyl)-1H-1,2,4-triazol-3-yl]phenol is sourced from PubChem (CID 3611136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).