C16H17N3O4 — CID 3611652
N-(1,3-benzodioxol-5-yl)-2-piperidin-3-yl-1,3-oxazole-4-carboxamide (PubChem CID 3611652) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-piperidin-3-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-piperidin-3-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3611652 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-piperidin-3-yl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1coc(C2CCCNC2)n1 |
| InChI | InChI=1S/C16H17N3O4/c20-15(18-11-3-4-13-14(6-11)23-9-22-13)12-8-21-16(19-12)10-2-1-5-17-7-10/h3-4,6,8,10,17H,1-2,5,7,9H2,(H,18,20) |
| InChIKey | VFIWKOYAVYALNN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |