C31H32F3N6OP — CID 3612215
4-[2,7-dimethyl-3,5-diphenyl-1-[2-(trifluoromethyl)phenyl]iminopyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl]-2,6-dimethylmorpholine (PubChem CID 3612215) has the molecular formula C31H32F3N6OP and a molecular weight of 592.61 g/mol. Its IUPAC name is 4-[2,7-dimethyl-3,5-diphenyl-1-[2-(trifluoromethyl)phenyl]iminopyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl]-2,6-dimethylmorpholine.
| Compound Name | 4-[2,7-dimethyl-3,5-diphenyl-1-[2-(trifluoromethyl)phenyl]iminopyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 3612215 |
| Molecular Formula | C31H32F3N6OP |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 4-[2,7-dimethyl-3,5-diphenyl-1-[2-(trifluoromethyl)phenyl]iminopyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl]-2,6-dimethylmorpholine |
| SMILES | Cc1nn(-c2ccccc2)c2c1P(=Nc1ccccc1C(F)(F)F)(N1CC(C)OC(C)C1)N(C)C(c1ccccc1)=N2 |
| InChI | InChI=1S/C31H32F3N6OP/c1-21-19-39(20-22(2)41-21)42(37-27-18-12-11-17-26(27)31(32,33)34)28-23(3)36-40(25-15-9-6-10-16-25)30(28)35-29(38(42)4)24-13-7-5-8-14-24/h5-18,21-22H,19-20H2,1-4H3 |
| InChIKey | IXELUSZHLTVZQF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 58.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|