C21H16ClN3O2S2 — CID 3612919
2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3612919) has the molecular formula C21H16ClN3O2S2 and a molecular weight of 441.97 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3612919 |
| Molecular Formula | C21H16ClN3O2S2 |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1)NCc1cccs1 |
| InChI | InChI=1S/C21H16ClN3O2S2/c22-14-7-9-15(10-8-14)25-20(27)17-5-1-2-6-18(17)24-21(25)29-13-19(26)23-12-16-4-3-11-28-16/h1-11H,12-13H2,(H,23,26) |
| InChIKey | YHODXEHGLUZABS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |