C24H29F3N3O5PS — CID 3613071
6-(2-diethoxyphosphorylpropan-2-ylimino)-2-(4-methoxyphenyl)-5-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one (PubChem CID 3613071) has the molecular formula C24H29F3N3O5PS and a molecular weight of 559.55 g/mol. Its IUPAC name is 6-(2-diethoxyphosphorylpropan-2-ylimino)-2-(4-methoxyphenyl)-5-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one.
| Compound Name | 6-(2-diethoxyphosphorylpropan-2-ylimino)-2-(4-methoxyphenyl)-5-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 3613071 |
| Molecular Formula | C24H29F3N3O5PS |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 6-(2-diethoxyphosphorylpropan-2-ylimino)-2-(4-methoxyphenyl)-5-phenyl-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
| SMILES | CCOP(=O)(OCC)C(C)(C)N=C1SC(c2ccc(OC)cc2)(C(F)(F)F)NC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H29F3N3O5PS/c1-6-34-36(32,35-7-2)22(3,4)29-21-30(18-11-9-8-10-12-18)20(31)28-23(37-21,24(25,26)27)17-13-15-19(33-5)16-14-17/h8-16H,6-7H2,1-5H3,(H,28,31) |
| InChIKey | NFBTZLFSRLXSKJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|