About 2-amino-4-nitrophenol
2-amino-4-nitrophenol (PubChem CID 3613389) has the molecular formula C6H6N2O3
and a molecular weight of 154.12 g/mol. Its IUPAC name is 2-amino-4-nitrophenol.
Molecular Properties
| Compound Name | 2-amino-4-nitrophenol |
| PubChem CID | 3613389 |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 2-amino-4-nitrophenol |
| SMILES | Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C6H6N2O3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H,7H2 |
| InChIKey | VLZVIIYRNMWPSN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-nitrophenol?
The IUPAC name of 2-amino-4-nitrophenol (CID 3613389) is 2-amino-4-nitrophenol.
What is the SMILES notation for 2-amino-4-nitrophenol?
The canonical SMILES for 2-amino-4-nitrophenol is Nc1cc([N+](=O)[O-])ccc1O.
What is the InChIKey of 2-amino-4-nitrophenol?
The InChIKey is VLZVIIYRNMWPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H,7H2.
What are the key properties of 2-amino-4-nitrophenol?
2-amino-4-nitrophenol has a molecular weight of 154.12 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-nitrophenol is sourced from PubChem (CID 3613389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).