About ethylidenethiourea
ethylidenethiourea (PubChem CID 3613496) has the molecular formula C3H6N2S
and a molecular weight of 102.16 g/mol. Its IUPAC name is ethylidenethiourea.
Molecular Properties
| Compound Name | ethylidenethiourea |
| PubChem CID | 3613496 |
| Molecular Formula | C3H6N2S |
| Molecular Weight | 102.16 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | ethylidenethiourea |
| SMILES | CC=NC(N)=S |
| InChI | InChI=1S/C3H6N2S/c1-2-5-3(4)6/h2H,1H3,(H2,4,6) |
| InChIKey | NDIUNRFKKUBPRJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethylidenethiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylidenethiourea?
The IUPAC name of ethylidenethiourea (CID 3613496) is ethylidenethiourea.
What is the SMILES notation for ethylidenethiourea?
The canonical SMILES for ethylidenethiourea is CC=NC(N)=S.
What is the InChIKey of ethylidenethiourea?
The InChIKey is NDIUNRFKKUBPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2S/c1-2-5-3(4)6/h2H,1H3,(H2,4,6).
What are the key properties of ethylidenethiourea?
ethylidenethiourea has a molecular weight of 102.16 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylidenethiourea is sourced from PubChem (CID 3613496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).