About 3,4-dimethoxythiophene
3,4-dimethoxythiophene (PubChem CID 3613501) has the molecular formula C6H8O2S
and a molecular weight of 144.19 g/mol. Its IUPAC name is 3,4-dimethoxythiophene.
Molecular Properties
| Compound Name | 3,4-dimethoxythiophene |
| PubChem CID | 3613501 |
| Molecular Formula | C6H8O2S |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | 3,4-dimethoxythiophene |
| SMILES | COc1cscc1OC |
| InChI | InChI=1S/C6H8O2S/c1-7-5-3-9-4-6(5)8-2/h3-4H,1-2H3 |
| InChIKey | ZUDCKLVMBAXBIF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethoxythiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethoxythiophene?
The IUPAC name of 3,4-dimethoxythiophene (CID 3613501) is 3,4-dimethoxythiophene.
What is the SMILES notation for 3,4-dimethoxythiophene?
The canonical SMILES for 3,4-dimethoxythiophene is COc1cscc1OC.
What is the InChIKey of 3,4-dimethoxythiophene?
The InChIKey is ZUDCKLVMBAXBIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2S/c1-7-5-3-9-4-6(5)8-2/h3-4H,1-2H3.
What are the key properties of 3,4-dimethoxythiophene?
3,4-dimethoxythiophene has a molecular weight of 144.19 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxythiophene is sourced from PubChem (CID 3613501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).