About (2-formylphenyl) thiocyanate
(2-formylphenyl) thiocyanate (PubChem CID 3613564) has the molecular formula C8H5NOS
and a molecular weight of 163.20 g/mol. Its IUPAC name is (2-formylphenyl) thiocyanate.
Molecular Properties
| Compound Name | (2-formylphenyl) thiocyanate |
| PubChem CID | 3613564 |
| Molecular Formula | C8H5NOS |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | (2-formylphenyl) thiocyanate |
| SMILES | N#CSc1ccccc1C=O |
| InChI | InChI=1S/C8H5NOS/c9-6-11-8-4-2-1-3-7(8)5-10/h1-5H |
| InChIKey | WXIBFNLLGAPNSJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2-formylphenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formylphenyl) thiocyanate?
The IUPAC name of (2-formylphenyl) thiocyanate (CID 3613564) is (2-formylphenyl) thiocyanate.
What is the SMILES notation for (2-formylphenyl) thiocyanate?
The canonical SMILES for (2-formylphenyl) thiocyanate is N#CSc1ccccc1C=O.
What is the InChIKey of (2-formylphenyl) thiocyanate?
The InChIKey is WXIBFNLLGAPNSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NOS/c9-6-11-8-4-2-1-3-7(8)5-10/h1-5H.
What are the key properties of (2-formylphenyl) thiocyanate?
(2-formylphenyl) thiocyanate has a molecular weight of 163.20 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formylphenyl) thiocyanate is sourced from PubChem (CID 3613564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).