About naphtho[2,1-b]quinolizin-12-ium
naphtho[2,1-b]quinolizin-12-ium (PubChem CID 3613582) has the molecular formula C17H12N+
and a molecular weight of 230.29 g/mol. Its IUPAC name is naphtho[2,1-b]quinolizin-12-ium.
Molecular Properties
| Compound Name | naphtho[2,1-b]quinolizin-12-ium |
| PubChem CID | 3613582 |
| Molecular Formula | C17H12N+ |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | naphtho[2,1-b]quinolizin-12-ium |
| SMILES | c1ccc2c(c1)ccc1cc3cccc[n+]3cc12 |
| InChI | InChI=1S/C17H12N/c1-2-7-16-13(5-1)8-9-14-11-15-6-3-4-10-18(15)12-17(14)16/h1-12H/q+1 |
| InChIKey | XIJAZDLUTLVFIU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 4.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze naphtho[2,1-b]quinolizin-12-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[2,1-b]quinolizin-12-ium?
The IUPAC name of naphtho[2,1-b]quinolizin-12-ium (CID 3613582) is naphtho[2,1-b]quinolizin-12-ium.
What is the SMILES notation for naphtho[2,1-b]quinolizin-12-ium?
The canonical SMILES for naphtho[2,1-b]quinolizin-12-ium is c1ccc2c(c1)ccc1cc3cccc[n+]3cc12.
What is the InChIKey of naphtho[2,1-b]quinolizin-12-ium?
The InChIKey is XIJAZDLUTLVFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N/c1-2-7-16-13(5-1)8-9-14-11-15-6-3-4-10-18(15)12-17(14)16/h1-12H/q+1.
What are the key properties of naphtho[2,1-b]quinolizin-12-ium?
naphtho[2,1-b]quinolizin-12-ium has a molecular weight of 230.29 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[2,1-b]quinolizin-12-ium is sourced from PubChem (CID 3613582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).