About N-decylbutanamide
N-decylbutanamide (PubChem CID 3614377) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is N-decylbutanamide.
Molecular Properties
| Compound Name | N-decylbutanamide |
| PubChem CID | 3614377 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N-decylbutanamide |
| SMILES | CCCCCCCCCCNC(=O)CCC |
| InChI | InChI=1S/C14H29NO/c1-3-5-6-7-8-9-10-11-13-15-14(16)12-4-2/h3-13H2,1-2H3,(H,15,16) |
| InChIKey | VNLRYCURXUALAI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-decylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decylbutanamide?
The IUPAC name of N-decylbutanamide (CID 3614377) is N-decylbutanamide.
What is the SMILES notation for N-decylbutanamide?
The canonical SMILES for N-decylbutanamide is CCCCCCCCCCNC(=O)CCC.
What is the InChIKey of N-decylbutanamide?
The InChIKey is VNLRYCURXUALAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-3-5-6-7-8-9-10-11-13-15-14(16)12-4-2/h3-13H2,1-2H3,(H,15,16).
What are the key properties of N-decylbutanamide?
N-decylbutanamide has a molecular weight of 227.39 g/mol, XLogP of 4.04, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-decylbutanamide is sourced from PubChem (CID 3614377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).