C13H19F6NO2 — CID 3614402
(3,4-dimethylcyclohexyl) N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate (PubChem CID 3614402) has the molecular formula C13H19F6NO2 and a molecular weight of 335.29 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl) N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate.
| Compound Name | (3,4-dimethylcyclohexyl) N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 3614402 |
| Molecular Formula | C13H19F6NO2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (3,4-dimethylcyclohexyl) N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate |
| SMILES | CC1CCC(OC(=O)NC(C)(C(F)(F)F)C(F)(F)F)CC1C |
| InChI | InChI=1S/C13H19F6NO2/c1-7-4-5-9(6-8(7)2)22-10(21)20-11(3,12(14,15)16)13(17,18)19/h7-9H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | HSYKUCUHSYQGQW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |