C6H8N2O2S — CID 3614677
5-(2-hydroxyethyl)-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 3614677) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-(2-hydroxyethyl)-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 3614677 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 5-(2-hydroxyethyl)-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]cc1CCO |
| InChI | InChI=1S/C6H8N2O2S/c9-2-1-4-3-7-6(11)8-5(4)10/h3,9H,1-2H2,(H2,7,8,10,11) |
| InChIKey | BHOFBQMOMPQKCN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|