C19H31NO2 — CID 3615080
1-(2,6-dimethylpiperidin-1-yl)-3-(4-propylphenoxy)propan-2-ol (PubChem CID 3615080) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperidin-1-yl)-3-(4-propylphenoxy)propan-2-ol.
| Compound Name | 1-(2,6-dimethylpiperidin-1-yl)-3-(4-propylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 3615080 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 1-(2,6-dimethylpiperidin-1-yl)-3-(4-propylphenoxy)propan-2-ol |
| SMILES | CCCc1ccc(OCC(O)CN2C(C)CCCC2C)cc1 |
| InChI | InChI=1S/C19H31NO2/c1-4-6-17-9-11-19(12-10-17)22-14-18(21)13-20-15(2)7-5-8-16(20)3/h9-12,15-16,18,21H,4-8,13-14H2,1-3H3 |
| InChIKey | ZSUACPZCTXTOEL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |