About 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide
2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide (PubChem CID 3615529) has the molecular formula C15H21FN2O2S
and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide.
Molecular Properties
| Compound Name | 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide |
| PubChem CID | 3615529 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide |
| SMILES | CCN(CC)C(=O)C(CSc1ccc(F)cc1)NC(C)=O |
| InChI | InChI=1S/C15H21FN2O2S/c1-4-18(5-2)15(20)14(17-11(3)19)10-21-13-8-6-12(16)7-9-13/h6-9,14H,4-5,10H2,1-3H3,(H,17,19) |
| InChIKey | GBUMUHFHKJOEKD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide?
The IUPAC name of 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide (CID 3615529) is 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide.
What is the SMILES notation for 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide?
The canonical SMILES for 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide is CCN(CC)C(=O)C(CSc1ccc(F)cc1)NC(C)=O.
What is the InChIKey of 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide?
The InChIKey is GBUMUHFHKJOEKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FN2O2S/c1-4-18(5-2)15(20)14(17-11(3)19)10-21-13-8-6-12(16)7-9-13/h6-9,14H,4-5,10H2,1-3H3,(H,17,19).
What are the key properties of 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide?
2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide has a molecular weight of 312.41 g/mol, XLogP of 2.29, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-N,N-diethyl-3-(4-fluorophenyl)sulfanylpropanamide is sourced from PubChem (CID 3615529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).