C19H18N2O4S — CID 3615552
3-[[5-(2,4-dimethylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 3615552) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3-[[5-(2,4-dimethylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 3-[[5-(2,4-dimethylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 3615552 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3-[[5-(2,4-dimethylanilino)-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | Cc1ccc(NC2SC(=O)N(Cc3cccc(C(=O)O)c3)C2=O)c(C)c1 |
| InChI | InChI=1S/C19H18N2O4S/c1-11-6-7-15(12(2)8-11)20-16-17(22)21(19(25)26-16)10-13-4-3-5-14(9-13)18(23)24/h3-9,16,20H,10H2,1-2H3,(H,23,24) |
| InChIKey | KZDBISQQFGPXMJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|