About 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine
2-tert-butylimidazo[1,2-a]benzimidazol-4-amine (PubChem CID 3615654) has the molecular formula C13H16N4
and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine.
Molecular Properties
| Compound Name | 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine |
| PubChem CID | 3615654 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine |
| SMILES | CC(C)(C)c1cn2c3ccccc3n(N)c2n1 |
| InChI | InChI=1S/C13H16N4/c1-13(2,3)11-8-16-9-6-4-5-7-10(9)17(14)12(16)15-11/h4-8H,14H2,1-3H3 |
| InChIKey | NRQMRFGZUYIELB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine?
The IUPAC name of 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine (CID 3615654) is 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine.
What is the SMILES notation for 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine?
The canonical SMILES for 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine is CC(C)(C)c1cn2c3ccccc3n(N)c2n1.
What is the InChIKey of 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine?
The InChIKey is NRQMRFGZUYIELB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4/c1-13(2,3)11-8-16-9-6-4-5-7-10(9)17(14)12(16)15-11/h4-8H,14H2,1-3H3.
What are the key properties of 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine?
2-tert-butylimidazo[1,2-a]benzimidazol-4-amine has a molecular weight of 228.30 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylimidazo[1,2-a]benzimidazol-4-amine is sourced from PubChem (CID 3615654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).