C22H20O4 — CID 3616723
4-(1-phenylethoxy)-3,4,4a,9a-tetrahydro-1H-anthracene-2,9,10-trione (PubChem CID 3616723) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-(1-phenylethoxy)-3,4,4a,9a-tetrahydro-1H-anthracene-2,9,10-trione.
| Compound Name | 4-(1-phenylethoxy)-3,4,4a,9a-tetrahydro-1H-anthracene-2,9,10-trione |
|---|---|
| PubChem CID | 3616723 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-(1-phenylethoxy)-3,4,4a,9a-tetrahydro-1H-anthracene-2,9,10-trione |
| SMILES | CC(OC1CC(=O)CC2C(=O)c3ccccc3C(=O)C12)c1ccccc1 |
| InChI | InChI=1S/C22H20O4/c1-13(14-7-3-2-4-8-14)26-19-12-15(23)11-18-20(19)22(25)17-10-6-5-9-16(17)21(18)24/h2-10,13,18-20H,11-12H2,1H3 |
| InChIKey | QPZYNQGSSNBJQS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|