C13H17NO5 — CID 3616929
3-[(Tetrahydrofuran-2-ylmethyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 3616929) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[(Tetrahydrofuran-2-ylmethyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 3616929 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-(oxolan-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | C1CC(OC1)CNC(=O)C2C3C=CC(C2C(=O)O)O3 |
| InChI | InChI=1S/C13H17NO5/c15-12(14-6-7-2-1-5-18-7)10-8-3-4-9(19-8)11(10)13(16)17/h3-4,7-11H,1-2,5-6H2,(H,14,15)(H,16,17) |
| InChIKey | WTXGQSXRJUJEMT-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 421 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|