C10H18O6 — CID 3617170
1-(2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)ethane-1,2-diol (PubChem CID 3617170) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)ethane-1,2-diol.
| Compound Name | 1-(2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 3617170 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-(2,6-dimethyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl)ethane-1,2-diol |
| SMILES | CC1OC2COC(C)OC2C(C(O)CO)O1 |
| InChI | InChI=1S/C10H18O6/c1-5-13-4-8-10(15-5)9(7(12)3-11)16-6(2)14-8/h5-12H,3-4H2,1-2H3 |
| InChIKey | GFJLQNXYQFWXMV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |