C23H21ClN2O4 — CID 3617616
N-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2,4-dimethoxybenzamide (PubChem CID 3617616) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is N-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2,4-dimethoxybenzamide.
| Compound Name | N-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3617616 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NN=Cc2ccc(OCc3ccc(Cl)cc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H21ClN2O4/c1-28-20-11-12-21(22(13-20)29-2)23(27)26-25-14-16-5-9-19(10-6-16)30-15-17-3-7-18(24)8-4-17/h3-14H,15H2,1-2H3,(H,26,27) |
| InChIKey | POAYLJJIJRLYQR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|