C25H29N3O6 — CID 3617927
[2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 3617927) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3617927 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC(=O)NC(=O)NC23CC4CC(CC(C4)C2)C3)ccc1OCC#N |
| InChI | InChI=1S/C25H29N3O6/c1-32-21-11-16(2-4-20(21)33-7-6-26)3-5-23(30)34-15-22(29)27-24(31)28-25-12-17-8-18(13-25)10-19(9-17)14-25/h2-5,11,17-19H,7-10,12-15H2,1H3,(H2,27,28,29,31) |
| InChIKey | MMCAQUUICNHKMA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|