C25H15N3O7S — CID 3618072
[1-[(1,3-dioxoisoindol-2-yl)iminomethyl]naphthalen-2-yl] 4-nitrobenzenesulfonate (PubChem CID 3618072) has the molecular formula C25H15N3O7S and a molecular weight of 501.48 g/mol. Its IUPAC name is [1-[(1,3-dioxoisoindol-2-yl)iminomethyl]naphthalen-2-yl] 4-nitrobenzenesulfonate.
| Compound Name | [1-[(1,3-dioxoisoindol-2-yl)iminomethyl]naphthalen-2-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3618072 |
| Molecular Formula | C25H15N3O7S |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | [1-[(1,3-dioxoisoindol-2-yl)iminomethyl]naphthalen-2-yl] 4-nitrobenzenesulfonate |
| SMILES | O=C1c2ccccc2C(=O)N1N=Cc1c(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)ccc2ccccc12 |
| InChI | InChI=1S/C25H15N3O7S/c29-24-20-7-3-4-8-21(20)25(30)27(24)26-15-22-19-6-2-1-5-16(19)9-14-23(22)35-36(33,34)18-12-10-17(11-13-18)28(31)32/h1-15H |
| InChIKey | LIPWNZLOVNHNRC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 136.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|