C6H14N4O8S2 — CID 3618199
2,3-dihydroxy-1-N',4-N'-bis(methylsulfonyl)butanedihydrazide (PubChem CID 3618199) has the molecular formula C6H14N4O8S2 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2,3-dihydroxy-1-N',4-N'-bis(methylsulfonyl)butanedihydrazide.
| Compound Name | 2,3-dihydroxy-1-N',4-N'-bis(methylsulfonyl)butanedihydrazide |
|---|---|
| PubChem CID | 3618199 |
| Molecular Formula | C6H14N4O8S2 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2,3-dihydroxy-1-N',4-N'-bis(methylsulfonyl)butanedihydrazide |
| SMILES | CS(=O)(=O)NNC(=O)C(O)C(O)C(=O)NNS(C)(=O)=O |
| InChI | InChI=1S/C6H14N4O8S2/c1-19(15,16)9-7-5(13)3(11)4(12)6(14)8-10-20(2,17)18/h3-4,9-12H,1-2H3,(H,7,13)(H,8,14) |
| InChIKey | LDRMUBLTZYHESU-UHFFFAOYSA-N |
| XLogP | -5.13 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | -5.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|