About 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid
5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid (PubChem CID 3618818) has the molecular formula C18H21ClN2O3
and a molecular weight of 348.83 g/mol. Its IUPAC name is 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid |
| PubChem CID | 3618818 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid |
| SMILES | CC1CC(C)CN(C(=O)Cc2c(C(=O)O)[nH]c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-10-5-11(2)9-21(8-10)16(22)7-14-13-6-12(19)3-4-15(13)20-17(14)18(23)24/h3-4,6,10-11,20H,5,7-9H2,1-2H3,(H,23,24) |
| InChIKey | QYPHOIYMMDYWFE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid?
The IUPAC name of 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid (CID 3618818) is 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid.
What is the SMILES notation for 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid?
The canonical SMILES for 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid is CC1CC(C)CN(C(=O)Cc2c(C(=O)O)[nH]c3ccc(Cl)cc23)C1.
What is the InChIKey of 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid?
The InChIKey is QYPHOIYMMDYWFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN2O3/c1-10-5-11(2)9-21(8-10)16(22)7-14-13-6-12(19)3-4-15(13)20-17(14)18(23)24/h3-4,6,10-11,20H,5,7-9H2,1-2H3,(H,23,24).
What are the key properties of 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid?
5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid has a molecular weight of 348.83 g/mol, XLogP of 3.57, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-1H-indole-2-carboxylic acid is sourced from PubChem (CID 3618818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).