About 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one
3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 3620861) has the molecular formula C13H14N2O3S
and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one |
| PubChem CID | 3620861 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COc1cc2[nH]c(=S)n(C3CC3)c(=O)c2cc1OC |
| InChI | InChI=1S/C13H14N2O3S/c1-17-10-5-8-9(6-11(10)18-2)14-13(19)15(12(8)16)7-3-4-7/h5-7H,3-4H2,1-2H3,(H,14,19) |
| InChIKey | BOMHESKRRZZQFW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one?
The IUPAC name of 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one (CID 3620861) is 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one.
What is the SMILES notation for 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one?
The canonical SMILES for 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one is COc1cc2[nH]c(=S)n(C3CC3)c(=O)c2cc1OC.
What is the InChIKey of 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one?
The InChIKey is BOMHESKRRZZQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3S/c1-17-10-5-8-9(6-11(10)18-2)14-13(19)15(12(8)16)7-3-4-7/h5-7H,3-4H2,1-2H3,(H,14,19).
What are the key properties of 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one?
3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one has a molecular weight of 278.33 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-6,7-dimethoxy-2-sulfanylidene-1H-quinazolin-4-one is sourced from PubChem (CID 3620861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).