About methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate
methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 3621608) has the molecular formula C21H19F2NO4
and a molecular weight of 387.38 g/mol. Its IUPAC name is methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
| PubChem CID | 3621608 |
| Molecular Formula | C21H19F2NO4 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1C(=O)C=C(Nc2ccc(F)cc2F)CC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H19F2NO4/c1-27-15-6-3-12(4-7-15)16-10-14(11-19(25)20(16)21(26)28-2)24-18-8-5-13(22)9-17(18)23/h3-9,11,16,20,24H,10H2,1-2H3 |
| InChIKey | RAJVALZDSQTAET-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate?
The IUPAC name of methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate (CID 3621608) is methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate.
What is the SMILES notation for methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate?
The canonical SMILES for methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate is COC(=O)C1C(=O)C=C(Nc2ccc(F)cc2F)CC1c1ccc(OC)cc1.
What is the InChIKey of methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate?
The InChIKey is RAJVALZDSQTAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2NO4/c1-27-15-6-3-12(4-7-15)16-10-14(11-19(25)20(16)21(26)28-2)24-18-8-5-13(22)9-17(18)23/h3-9,11,16,20,24H,10H2,1-2H3.
What are the key properties of methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate?
methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate has a molecular weight of 387.38 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,4-difluoroanilino)-6-(4-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 3621608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).