About 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine
1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine (PubChem CID 3621729) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine.
Molecular Properties
| Compound Name | 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine |
| PubChem CID | 3621729 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine |
| SMILES | CC(c1ccccc1)C1OCC(CN2CCCCC2)O1 |
| InChI | InChI=1S/C17H25NO2/c1-14(15-8-4-2-5-9-15)17-19-13-16(20-17)12-18-10-6-3-7-11-18/h2,4-5,8-9,14,16-17H,3,6-7,10-13H2,1H3 |
| InChIKey | ODYIWFSYHAIAAO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine?
The IUPAC name of 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine (CID 3621729) is 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine.
What is the SMILES notation for 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine?
The canonical SMILES for 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine is CC(c1ccccc1)C1OCC(CN2CCCCC2)O1.
What is the InChIKey of 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine?
The InChIKey is ODYIWFSYHAIAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-14(15-8-4-2-5-9-15)17-19-13-16(20-17)12-18-10-6-3-7-11-18/h2,4-5,8-9,14,16-17H,3,6-7,10-13H2,1H3.
What are the key properties of 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine?
1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine has a molecular weight of 275.39 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(1-phenylethyl)-1,3-dioxolan-4-yl]methyl]piperidine is sourced from PubChem (CID 3621729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).