C19H20N2O5 — CID 3622585
(3-nitrophenyl)methyl 4-(2,4-dimethylanilino)-4-oxobutanoate (PubChem CID 3622585) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 4-(2,4-dimethylanilino)-4-oxobutanoate.
| Compound Name | (3-nitrophenyl)methyl 4-(2,4-dimethylanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 3622585 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (3-nitrophenyl)methyl 4-(2,4-dimethylanilino)-4-oxobutanoate |
| SMILES | Cc1ccc(NC(=O)CCC(=O)OCc2cccc([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-13-6-7-17(14(2)10-13)20-18(22)8-9-19(23)26-12-15-4-3-5-16(11-15)21(24)25/h3-7,10-11H,8-9,12H2,1-2H3,(H,20,22) |
| InChIKey | BOWCXPZMDKXKDG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|