C24H19FN4O5 — CID 3622589
2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 3622589) has the molecular formula C24H19FN4O5 and a molecular weight of 462.44 g/mol. Its IUPAC name is 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 3622589 |
| Molecular Formula | C24H19FN4O5 |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-[2-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | COc1cccc(C=Nn2c(=O)[nH]c3ccccc3c2=O)c1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C24H19FN4O5/c1-33-20-12-6-7-15(22(20)34-14-21(30)27-19-11-5-3-9-17(19)25)13-26-29-23(31)16-8-2-4-10-18(16)28-24(29)32/h2-13H,14H2,1H3,(H,27,30)(H,28,32) |
| InChIKey | HLFNDXSVXSZBPR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|