C16H24N2O4S — CID 3623028
propan-2-yl N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]carbamate (PubChem CID 3623028) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is propan-2-yl N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]carbamate.
| Compound Name | propan-2-yl N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 3623028 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | propan-2-yl N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(NC(=O)OC(C)C)CC2)cc1 |
| InChI | InChI=1S/C16H24N2O4S/c1-12(2)22-16(19)17-14-8-10-18(11-9-14)23(20,21)15-6-4-13(3)5-7-15/h4-7,12,14H,8-11H2,1-3H3,(H,17,19) |
| InChIKey | VHMQIQRRDCVCIQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |