About 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine
2,4,5-trifluoro-6-nitrobenzene-1,3-diamine (PubChem CID 3623219) has the molecular formula C6H4F3N3O2
and a molecular weight of 207.11 g/mol. Its IUPAC name is 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine.
Molecular Properties
| Compound Name | 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine |
| PubChem CID | 3623219 |
| Molecular Formula | C6H4F3N3O2 |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine |
| SMILES | Nc1c(F)c(N)c([N+](=O)[O-])c(F)c1F |
| InChI | InChI=1S/C6H4F3N3O2/c7-1-2(8)6(12(13)14)5(11)3(9)4(1)10/h10-11H2 |
| InChIKey | HGYLISKVTLKRJJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine?
The IUPAC name of 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine (CID 3623219) is 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine.
What is the SMILES notation for 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine?
The canonical SMILES for 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine is Nc1c(F)c(N)c([N+](=O)[O-])c(F)c1F.
What is the InChIKey of 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine?
The InChIKey is HGYLISKVTLKRJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3N3O2/c7-1-2(8)6(12(13)14)5(11)3(9)4(1)10/h10-11H2.
What are the key properties of 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine?
2,4,5-trifluoro-6-nitrobenzene-1,3-diamine has a molecular weight of 207.11 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trifluoro-6-nitrobenzene-1,3-diamine is sourced from PubChem (CID 3623219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).