C20H21Cl2N5O — CID 3623395
N-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,5-dimethylpyrazol-4-yl)prop-2-enamide (PubChem CID 3623395) has the molecular formula C20H21Cl2N5O and a molecular weight of 418.33 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,5-dimethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,5-dimethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3623395 |
| Molecular Formula | C20H21Cl2N5O |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,5-dimethylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2Cl)c(C)c1NC(=O)C=Cc1cnn(C)c1C |
| InChI | InChI=1S/C20H21Cl2N5O/c1-12-20(24-19(28)8-6-15-10-23-26(4)13(15)2)14(3)27(25-12)11-16-5-7-17(21)9-18(16)22/h5-10H,11H2,1-4H3,(H,24,28) |
| InChIKey | BIHQSDIDSAPCFT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|