C22H22BrNO6 — CID 3623616
5-(4-bromophenyl)-1-[2-(2-hydroxyethoxy)ethyl]-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 3623616) has the molecular formula C22H22BrNO6 and a molecular weight of 476.32 g/mol. Its IUPAC name is 5-(4-bromophenyl)-1-[2-(2-hydroxyethoxy)ethyl]-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(4-bromophenyl)-1-[2-(2-hydroxyethoxy)ethyl]-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3623616 |
| Molecular Formula | C22H22BrNO6 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 5-(4-bromophenyl)-1-[2-(2-hydroxyethoxy)ethyl]-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(CCOCCO)C2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H22BrNO6/c1-29-17-8-4-15(5-9-17)20(26)18-19(14-2-6-16(23)7-3-14)24(22(28)21(18)27)10-12-30-13-11-25/h2-9,19,25-26H,10-13H2,1H3 |
| InChIKey | JJFHYDMGDCZXJD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|