About 2-propoxypyrido[1,2-a]pyrimidin-4-one
2-propoxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 3623775) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-propoxypyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-propoxypyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 3623775 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-propoxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCOc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C11H12N2O2/c1-2-7-15-10-8-11(14)13-6-4-3-5-9(13)12-10/h3-6,8H,2,7H2,1H3 |
| InChIKey | ADWLEQHYPMISKG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propoxypyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxypyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-propoxypyrido[1,2-a]pyrimidin-4-one (CID 3623775) is 2-propoxypyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-propoxypyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-propoxypyrido[1,2-a]pyrimidin-4-one is CCCOc1cc(=O)n2ccccc2n1.
What is the InChIKey of 2-propoxypyrido[1,2-a]pyrimidin-4-one?
The InChIKey is ADWLEQHYPMISKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-2-7-15-10-8-11(14)13-6-4-3-5-9(13)12-10/h3-6,8H,2,7H2,1H3.
What are the key properties of 2-propoxypyrido[1,2-a]pyrimidin-4-one?
2-propoxypyrido[1,2-a]pyrimidin-4-one has a molecular weight of 204.23 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxypyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 3623775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).