C18H16ClN3O3S — CID 3624900
4-chloro-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-nitrobenzamide (PubChem CID 3624900) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is 4-chloro-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-nitrobenzamide.
| Compound Name | 4-chloro-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 3624900 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 4-chloro-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-nitrobenzamide |
| SMILES | CCC1CCc2c(sc(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2C#N)C1 |
| InChI | InChI=1S/C18H16ClN3O3S/c1-2-10-3-5-12-13(9-20)18(26-16(12)7-10)21-17(23)11-4-6-14(19)15(8-11)22(24)25/h4,6,8,10H,2-3,5,7H2,1H3,(H,21,23) |
| InChIKey | QCTGMTGBNGDTNU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|