C23H14ClFN2O4S2 — CID 3625164
5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 3625164) has the molecular formula C23H14ClFN2O4S2 and a molecular weight of 500.96 g/mol. Its IUPAC name is 5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3625164 |
| Molecular Formula | C23H14ClFN2O4S2 |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | 5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc(Sc3ccc(Cl)cc3)c([N+](=O)[O-])c2)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C23H14ClFN2O4S2/c24-16-6-8-17(9-7-16)32-20-10-5-14(11-19(20)27(30)31)12-21-22(28)26(23(29)33-21)13-15-3-1-2-4-18(15)25/h1-12H,13H2 |
| InChIKey | LVXVWHULHYTTJG-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|