About 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one
7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 3625279) has the molecular formula C16H15NO2
and a molecular weight of 253.30 g/mol. Its IUPAC name is 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one.
Molecular Properties
| Compound Name | 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one |
| PubChem CID | 3625279 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | COc1ccc2c(c1)C(c1ccccc1)NC(=O)C2 |
| InChI | InChI=1S/C16H15NO2/c1-19-13-8-7-12-9-15(18)17-16(14(12)10-13)11-5-3-2-4-6-11/h2-8,10,16H,9H2,1H3,(H,17,18) |
| InChIKey | DQMHTMYONMEBJW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one?
The IUPAC name of 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one (CID 3625279) is 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one.
What is the SMILES notation for 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one?
The canonical SMILES for 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one is COc1ccc2c(c1)C(c1ccccc1)NC(=O)C2.
What is the InChIKey of 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one?
The InChIKey is DQMHTMYONMEBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c1-19-13-8-7-12-9-15(18)17-16(14(12)10-13)11-5-3-2-4-6-11/h2-8,10,16H,9H2,1H3,(H,17,18).
What are the key properties of 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one?
7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one has a molecular weight of 253.30 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1-phenyl-2,4-dihydro-1H-isoquinolin-3-one is sourced from PubChem (CID 3625279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).