About dimethyl-(2,4,6-trichlorophenyl)silane
dimethyl-(2,4,6-trichlorophenyl)silane (PubChem CID 3625567) has the molecular formula C8H9Cl3Si
and a molecular weight of 239.60 g/mol. Its IUPAC name is dimethyl-(2,4,6-trichlorophenyl)silane.
Molecular Properties
| Compound Name | dimethyl-(2,4,6-trichlorophenyl)silane |
| PubChem CID | 3625567 |
| Molecular Formula | C8H9Cl3Si |
| Molecular Weight | 239.60 g/mol |
| Exact Mass | 237.95 |
| IUPAC Name | dimethyl-(2,4,6-trichlorophenyl)silane |
| SMILES | C[SiH](C)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C8H9Cl3Si/c1-12(2)8-6(10)3-5(9)4-7(8)11/h3-4,12H,1-2H3 |
| InChIKey | PFZKBVDHIVBUOE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(2,4,6-trichlorophenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(2,4,6-trichlorophenyl)silane?
The IUPAC name of dimethyl-(2,4,6-trichlorophenyl)silane (CID 3625567) is dimethyl-(2,4,6-trichlorophenyl)silane.
What is the SMILES notation for dimethyl-(2,4,6-trichlorophenyl)silane?
The canonical SMILES for dimethyl-(2,4,6-trichlorophenyl)silane is C[SiH](C)c1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of dimethyl-(2,4,6-trichlorophenyl)silane?
The InChIKey is PFZKBVDHIVBUOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl3Si/c1-12(2)8-6(10)3-5(9)4-7(8)11/h3-4,12H,1-2H3.
What are the key properties of dimethyl-(2,4,6-trichlorophenyl)silane?
dimethyl-(2,4,6-trichlorophenyl)silane has a molecular weight of 239.60 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(2,4,6-trichlorophenyl)silane is sourced from PubChem (CID 3625567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).