C5H7F6O3P — CID 3625610
1,1,1-trifluoro-2-[methyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane (PubChem CID 3625610) has the molecular formula C5H7F6O3P and a molecular weight of 260.07 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[methyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane.
| Compound Name | 1,1,1-trifluoro-2-[methyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane |
|---|---|
| PubChem CID | 3625610 |
| Molecular Formula | C5H7F6O3P |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1,1,1-trifluoro-2-[methyl(2,2,2-trifluoroethoxy)phosphoryl]oxyethane |
| SMILES | CP(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C5H7F6O3P/c1-15(12,13-2-4(6,7)8)14-3-5(9,10)11/h2-3H2,1H3 |
| InChIKey | YIUFTMLPQFZEFD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|