C9H11N3O2 — CID 3626006
N,N-bis(cyanomethyl)oxolane-2-carboxamide (PubChem CID 3626006) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)oxolane-2-carboxamide.
| Compound Name | N,N-bis(cyanomethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 3626006 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N,N-bis(cyanomethyl)oxolane-2-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)C1CCCO1 |
| InChI | InChI=1S/C9H11N3O2/c10-3-5-12(6-4-11)9(13)8-2-1-7-14-8/h8H,1-2,5-7H2 |
| InChIKey | PXGMKZAOCLVMDU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|