About 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate
4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate (PubChem CID 3626251) has the molecular formula C18H16N3O2S-
and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate.
Molecular Properties
| Compound Name | 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate |
| PubChem CID | 3626251 |
| Molecular Formula | C18H16N3O2S- |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate |
| SMILES | C=C(NNc1ccc(C(=O)[O-])cc1)C1=C(C)Nc2ccccc2S1 |
| InChI | InChI=1S/C18H17N3O2S/c1-11-17(24-16-6-4-3-5-15(16)19-11)12(2)20-21-14-9-7-13(8-10-14)18(22)23/h3-10,19-21H,2H2,1H3,(H,22,23)/p-1 |
| InChIKey | PMAYSPHODUOVSG-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate?
The IUPAC name of 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate (CID 3626251) is 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate.
What is the SMILES notation for 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate?
The canonical SMILES for 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate is C=C(NNc1ccc(C(=O)[O-])cc1)C1=C(C)Nc2ccccc2S1.
What is the InChIKey of 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate?
The InChIKey is PMAYSPHODUOVSG-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H17N3O2S/c1-11-17(24-16-6-4-3-5-15(16)19-11)12(2)20-21-14-9-7-13(8-10-14)18(22)23/h3-10,19-21H,2H2,1H3,(H,22,23)/p-1.
What are the key properties of 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate?
4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate has a molecular weight of 338.41 g/mol, XLogP of 2.93, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethenyl]hydrazinyl]benzoate is sourced from PubChem (CID 3626251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).