C45H49F3N2O6 — CID 3627044
1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-3-(4-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 3627044) has the molecular formula C45H49F3N2O6 and a molecular weight of 770.89 g/mol. Its IUPAC name is 1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-3-(4-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-3-(4-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3627044 |
| Molecular Formula | C45H49F3N2O6 |
| Molecular Weight | 770.89 g/mol |
| Exact Mass | 770.35 |
| IUPAC Name | 1-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]-3-(4-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | COc1ccc(NC(=O)N(Cc2ccc(OC(F)(F)F)cc2)CC2(O)CCC3c4ccc(cc4C(=O)c4ccccc4)CC(O)CCC(C)=CCCC32C)cc1 |
| InChI | InChI=1S/C45H49F3N2O6/c1-30-8-7-24-43(2)40(38-22-14-32(26-35(51)17-11-30)27-39(38)41(52)33-9-5-4-6-10-33)23-25-44(43,54)29-50(42(53)49-34-15-20-36(55-3)21-16-34)28-31-12-18-37(19-13-31)56-45(46,47)48/h4-6,8-10,12-16,18-22,27,35,40,51,54H,7,11,17,23-26,28-29H2,1-3H3,(H,49,53) |
| InChIKey | IWXKDIPCZXPZDK-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.89 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|