C25H33NO5S — CID 3627217
3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-(3,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 3627217) has the molecular formula C25H33NO5S and a molecular weight of 459.61 g/mol. Its IUPAC name is 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-(3,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-(3,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3627217 |
| Molecular Formula | C25H33NO5S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-(3,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(C)(C)c1cc(CN2C(C(=O)O)CSC2c2ccc(O)c(O)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H33NO5S/c1-24(2,3)16-9-14(10-17(21(16)29)25(4,5)6)12-26-18(23(30)31)13-32-22(26)15-7-8-19(27)20(28)11-15/h7-11,18,22,27-29H,12-13H2,1-6H3,(H,30,31) |
| InChIKey | VYWYNGGIYUIXOQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|