About N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide
N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide (PubChem CID 3627573) has the molecular formula C16H20ClNO3S
and a molecular weight of 341.86 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide |
| PubChem CID | 3627573 |
| Molecular Formula | C16H20ClNO3S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)Nc1ccc(Cl)cc1)C(=O)C2 |
| InChI | InChI=1S/C16H20ClNO3S/c1-15(2)11-7-8-16(15,14(19)9-11)10-22(20,21)18-13-5-3-12(17)4-6-13/h3-6,11,18H,7-10H2,1-2H3 |
| InChIKey | NGICSCAPXCPSTL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide?
The IUPAC name of N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide (CID 3627573) is N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide.
What is the SMILES notation for N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide?
The canonical SMILES for N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide is CC1(C)C2CCC1(CS(=O)(=O)Nc1ccc(Cl)cc1)C(=O)C2.
What is the InChIKey of N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide?
The InChIKey is NGICSCAPXCPSTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClNO3S/c1-15(2)11-7-8-16(15,14(19)9-11)10-22(20,21)18-13-5-3-12(17)4-6-13/h3-6,11,18H,7-10H2,1-2H3.
What are the key properties of N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide?
N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide has a molecular weight of 341.86 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonamide is sourced from PubChem (CID 3627573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).