About 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea
1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea (PubChem CID 3627728) has the molecular formula C11H22N2O5S
and a molecular weight of 294.37 g/mol. Its IUPAC name is 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea.
Molecular Properties
| Compound Name | 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea |
| PubChem CID | 3627728 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea |
| SMILES | CCCCNC(=S)NC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C11H22N2O5S/c1-2-3-4-12-11(19)13-10-9(17)8(16)7(15)6(5-14)18-10/h6-10,14-17H,2-5H2,1H3,(H2,12,13,19) |
| InChIKey | DGDXQFRDCRNXJN-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 114.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea?
The IUPAC name of 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea (CID 3627728) is 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea.
What is the SMILES notation for 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea?
The canonical SMILES for 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea is CCCCNC(=S)NC1OC(CO)C(O)C(O)C1O.
What is the InChIKey of 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea?
The InChIKey is DGDXQFRDCRNXJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O5S/c1-2-3-4-12-11(19)13-10-9(17)8(16)7(15)6(5-14)18-10/h6-10,14-17H,2-5H2,1H3,(H2,12,13,19).
What are the key properties of 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea?
1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea has a molecular weight of 294.37 g/mol, XLogP of -1.95, 5 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea is sourced from PubChem (CID 3627728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).