About 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide
4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide (PubChem CID 3627793) has the molecular formula C28H21N3O3S
and a molecular weight of 479.56 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide |
| PubChem CID | 3627793 |
| Molecular Formula | C28H21N3O3S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1nn(-c2ccccc2)c(-c2ccccc2)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H21N3O3S/c32-28(29-22-15-7-2-8-16-22)25-27(35(33,34)24-19-11-4-12-20-24)26(21-13-5-1-6-14-21)31(30-25)23-17-9-3-10-18-23/h1-20H,(H,29,32) |
| InChIKey | GYRHSBFBFFISDE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide?
The IUPAC name of 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide (CID 3627793) is 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide.
What is the SMILES notation for 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide?
The canonical SMILES for 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide is O=C(Nc1ccccc1)c1nn(-c2ccccc2)c(-c2ccccc2)c1S(=O)(=O)c1ccccc1.
What is the InChIKey of 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide?
The InChIKey is GYRHSBFBFFISDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H21N3O3S/c32-28(29-22-15-7-2-8-16-22)25-27(35(33,34)24-19-11-4-12-20-24)26(21-13-5-1-6-14-21)31(30-25)23-17-9-3-10-18-23/h1-20H,(H,29,32).
What are the key properties of 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide?
4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide has a molecular weight of 479.56 g/mol, XLogP of 5.62, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfonyl)-N,1,5-triphenylpyrazole-3-carboxamide is sourced from PubChem (CID 3627793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).