About 2-(2-methoxyethoxy)-N,N-dimethylethanamine
2-(2-methoxyethoxy)-N,N-dimethylethanamine (PubChem CID 3627997) has the molecular formula C7H17NO2
and a molecular weight of 147.22 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)-N,N-dimethylethanamine |
| PubChem CID | 3627997 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | 2-(2-methoxyethoxy)-N,N-dimethylethanamine |
| SMILES | COCCOCCN(C)C |
| InChI | InChI=1S/C7H17NO2/c1-8(2)4-5-10-7-6-9-3/h4-7H2,1-3H3 |
| InChIKey | QMLHYLGVIZZSLC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)-N,N-dimethylethanamine?
The IUPAC name of 2-(2-methoxyethoxy)-N,N-dimethylethanamine (CID 3627997) is 2-(2-methoxyethoxy)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(2-methoxyethoxy)-N,N-dimethylethanamine?
The canonical SMILES for 2-(2-methoxyethoxy)-N,N-dimethylethanamine is COCCOCCN(C)C.
What is the InChIKey of 2-(2-methoxyethoxy)-N,N-dimethylethanamine?
The InChIKey is QMLHYLGVIZZSLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO2/c1-8(2)4-5-10-7-6-9-3/h4-7H2,1-3H3.
What are the key properties of 2-(2-methoxyethoxy)-N,N-dimethylethanamine?
2-(2-methoxyethoxy)-N,N-dimethylethanamine has a molecular weight of 147.22 g/mol, XLogP of 0.21, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)-N,N-dimethylethanamine is sourced from PubChem (CID 3627997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).