C13H17BrN4O3 — CID 3628349
2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)-N-(3-methylpent-1-yn-3-yl)propanamide (PubChem CID 3628349) has the molecular formula C13H17BrN4O3 and a molecular weight of 357.21 g/mol. Its IUPAC name is 2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)-N-(3-methylpent-1-yn-3-yl)propanamide.
| Compound Name | 2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)-N-(3-methylpent-1-yn-3-yl)propanamide |
|---|---|
| PubChem CID | 3628349 |
| Molecular Formula | C13H17BrN4O3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)-N-(3-methylpent-1-yn-3-yl)propanamide |
| SMILES | C#CC(C)(CC)NC(=O)C(C)n1nc([N+](=O)[O-])c(Br)c1C |
| InChI | InChI=1S/C13H17BrN4O3/c1-6-13(5,7-2)15-12(19)9(4)17-8(3)10(14)11(16-17)18(20)21/h1,9H,7H2,2-5H3,(H,15,19) |
| InChIKey | LUDDUTYTPRRTAB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|