About diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate
diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate (PubChem CID 3629132) has the molecular formula C22H24O10
and a molecular weight of 448.42 g/mol. Its IUPAC name is diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate |
| PubChem CID | 3629132 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate |
| SMILES | CCOC(=O)C1=CC(=C2C=C(C(=O)OCC)OC(C(=O)OCC)=C2)C=C(C(=O)OCC)O1 |
| InChI | InChI=1S/C22H24O10/c1-5-27-19(23)15-9-13(10-16(31-15)20(24)28-6-2)14-11-17(21(25)29-7-3)32-18(12-14)22(26)30-8-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | WPJIHKWMBTWYBJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate?
The IUPAC name of diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate (CID 3629132) is diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate.
What is the SMILES notation for diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate?
The canonical SMILES for diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate is CCOC(=O)C1=CC(=C2C=C(C(=O)OCC)OC(C(=O)OCC)=C2)C=C(C(=O)OCC)O1.
What is the InChIKey of diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate?
The InChIKey is WPJIHKWMBTWYBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O10/c1-5-27-19(23)15-9-13(10-16(31-15)20(24)28-6-2)14-11-17(21(25)29-7-3)32-18(12-14)22(26)30-8-4/h9-12H,5-8H2,1-4H3.
What are the key properties of diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate?
diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate has a molecular weight of 448.42 g/mol, XLogP of 2.13, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-[2,6-bis(ethoxycarbonyl)pyran-4-ylidene]pyran-2,6-dicarboxylate is sourced from PubChem (CID 3629132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).